C15H20N2O3 — CID 94219466
2-(2,6-dimethylphenoxy)-N-[(3R)-2-oxopiperidin-3-yl]acetamide (PubChem CID 94219466) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-[(3R)-2-oxopiperidin-3-yl]acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-[(3R)-2-oxopiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 94219466 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-[(3R)-2-oxopiperidin-3-yl]acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C15H20N2O3/c1-10-5-3-6-11(2)14(10)20-9-13(18)17-12-7-4-8-16-15(12)19/h3,5-6,12H,4,7-9H2,1-2H3,(H,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | UUGBOIMWXNQOGQ-GFCCVEGCSA-N |
| XLogP | 1.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |