C9H7F3N2O3S — CID 94230811
(E)-3-[2-(3,3,3-trifluoropropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 94230811) has the molecular formula C9H7F3N2O3S and a molecular weight of 280.23 g/mol. Its IUPAC name is (E)-3-[2-(3,3,3-trifluoropropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3,3,3-trifluoropropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94230811 |
| Molecular Formula | C9H7F3N2O3S |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (E)-3-[2-(3,3,3-trifluoropropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NC(=O)CC(F)(F)F)s1 |
| InChI | InChI=1S/C9H7F3N2O3S/c10-9(11,12)3-6(15)14-8-13-4-5(18-8)1-2-7(16)17/h1-2,4H,3H2,(H,16,17)(H,13,14,15)/b2-1+ |
| InChIKey | YSUAUVKEHXQTBX-OWOJBTEDSA-N |
| XLogP | 2.13 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|