C12H11N3O2S — CID 94233211
(E)-3-[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]prop-2-enoic acid (PubChem CID 94233211) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is (E)-3-[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94233211 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (E)-3-[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H11N3O2S/c16-11(17)6-5-9-1-3-10(4-2-9)7-18-12-13-8-14-15-12/h1-6,8H,7H2,(H,16,17)(H,13,14,15)/b6-5+ |
| InChIKey | CBPTUTUUBTZFBG-AATRIKPKSA-N |
| XLogP | 2.19 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|