About (2R)-2-pyridin-4-yl-1,3-oxazolidine
(2R)-2-pyridin-4-yl-1,3-oxazolidine (PubChem CID 94252095) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is (2R)-2-pyridin-4-yl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2R)-2-pyridin-4-yl-1,3-oxazolidine |
| PubChem CID | 94252095 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (2R)-2-pyridin-4-yl-1,3-oxazolidine |
| SMILES | c1cc([C@@H]2NCCO2)ccn1 |
| InChI | InChI=1S/C8H10N2O/c1-3-9-4-2-7(1)8-10-5-6-11-8/h1-4,8,10H,5-6H2/t8-/m1/s1 |
| InChIKey | AUWQHIJVZVQJAP-MRVPVSSYSA-N |
| XLogP | 0.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-pyridin-4-yl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-pyridin-4-yl-1,3-oxazolidine?
The IUPAC name of (2R)-2-pyridin-4-yl-1,3-oxazolidine (CID 94252095) is (2R)-2-pyridin-4-yl-1,3-oxazolidine.
What is the SMILES notation for (2R)-2-pyridin-4-yl-1,3-oxazolidine?
The canonical SMILES for (2R)-2-pyridin-4-yl-1,3-oxazolidine is c1cc([C@@H]2NCCO2)ccn1.
What is the InChIKey of (2R)-2-pyridin-4-yl-1,3-oxazolidine?
The InChIKey is AUWQHIJVZVQJAP-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-3-9-4-2-7(1)8-10-5-6-11-8/h1-4,8,10H,5-6H2/t8-/m1/s1.
What are the key properties of (2R)-2-pyridin-4-yl-1,3-oxazolidine?
(2R)-2-pyridin-4-yl-1,3-oxazolidine has a molecular weight of 150.18 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-pyridin-4-yl-1,3-oxazolidine is sourced from PubChem (CID 94252095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).