C9H14N2O2 — CID 94252864
(2R)-3-(pyridin-3-ylmethylamino)propane-1,2-diol (PubChem CID 94252864) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R)-3-(pyridin-3-ylmethylamino)propane-1,2-diol.
| Compound Name | (2R)-3-(pyridin-3-ylmethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 94252864 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (2R)-3-(pyridin-3-ylmethylamino)propane-1,2-diol |
| SMILES | OC[C@H](O)CNCc1cccnc1 |
| InChI | InChI=1S/C9H14N2O2/c12-7-9(13)6-11-5-8-2-1-3-10-4-8/h1-4,9,11-13H,5-7H2/t9-/m1/s1 |
| InChIKey | FVQNWIOJMWSRAS-SECBINFHSA-N |
| XLogP | -0.48 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |