C13H22N6O — CID 942534
N,N-dimethyl-4-piperidin-1-yl-6-(propan-2-ylideneamino)oxy-1,3,5-triazin-2-amine (PubChem CID 942534) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is N,N-dimethyl-4-piperidin-1-yl-6-(propan-2-ylideneamino)oxy-1,3,5-triazin-2-amine.
| Compound Name | N,N-dimethyl-4-piperidin-1-yl-6-(propan-2-ylideneamino)oxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 942534 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | N,N-dimethyl-4-piperidin-1-yl-6-(propan-2-ylideneamino)oxy-1,3,5-triazin-2-amine |
| SMILES | CC(C)=NOc1nc(N(C)C)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C13H22N6O/c1-10(2)17-20-13-15-11(18(3)4)14-12(16-13)19-8-6-5-7-9-19/h5-9H2,1-4H3 |
| InChIKey | PIDJADDVKRXJAB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|