C14H21N3O2S — CID 9425726
1-tert-butyl-3-[[2-(2-methoxyphenyl)acetyl]amino]thiourea (PubChem CID 9425726) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-tert-butyl-3-[[2-(2-methoxyphenyl)acetyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[2-(2-methoxyphenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9425726 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-tert-butyl-3-[[2-(2-methoxyphenyl)acetyl]amino]thiourea |
| SMILES | COc1ccccc1CC(=O)NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C14H21N3O2S/c1-14(2,3)15-13(20)17-16-12(18)9-10-7-5-6-8-11(10)19-4/h5-8H,9H2,1-4H3,(H,16,18)(H2,15,17,20) |
| InChIKey | CKIIMRITOBPJEB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|