C19H27N5O3S — CID 9425865
1-tert-butyl-3-[[2-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetyl]amino]thiourea (PubChem CID 9425865) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-tert-butyl-3-[[2-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[2-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9425865 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-tert-butyl-3-[[2-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetyl]amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)CN1C(=O)N[C@](C)(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H27N5O3S/c1-18(2,3)20-16(28)23-22-14(25)12-24-15(26)19(4,21-17(24)27)11-10-13-8-6-5-7-9-13/h5-9H,10-12H2,1-4H3,(H,21,27)(H,22,25)(H2,20,23,28)/t19-/m1/s1 |
| InChIKey | SFYJPVBWLPWOEU-LJQANCHMSA-N |
| XLogP | 1.22 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|