C20H20ClN2O+ — CID 942596
1-[(2-chlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium (PubChem CID 942596) has the molecular formula C20H20ClN2O+ and a molecular weight of 339.85 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium |
|---|---|
| PubChem CID | 942596 |
| Molecular Formula | C20H20ClN2O+ |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium |
| SMILES | COc1ccc(-c2c[n+](Cc3ccccc3Cl)c3n2CCC3)cc1 |
| InChI | InChI=1S/C20H20ClN2O/c1-24-17-10-8-15(9-11-17)19-14-22(20-7-4-12-23(19)20)13-16-5-2-3-6-18(16)21/h2-3,5-6,8-11,14H,4,7,12-13H2,1H3/q+1 |
| InChIKey | TYQBVFAEPCLITM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|