C13H16FNO3 — CID 94270213
N,N-diethyl-2-(3-fluoro-4-methoxyphenyl)-2-oxoacetamide (PubChem CID 94270213) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is N,N-diethyl-2-(3-fluoro-4-methoxyphenyl)-2-oxoacetamide.
| Compound Name | N,N-diethyl-2-(3-fluoro-4-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 94270213 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N,N-diethyl-2-(3-fluoro-4-methoxyphenyl)-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)C(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H16FNO3/c1-4-15(5-2)13(17)12(16)9-6-7-11(18-3)10(14)8-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | WSLTVPRTGFEKPN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|