C21H27N3O4S — CID 9427293
N-[2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl]-4-(propan-2-ylsulfamoyl)benzamide (PubChem CID 9427293) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl]-4-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl]-4-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9427293 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl]-4-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)NCC(=O)NC[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O4S/c1-15(2)24-29(27,28)19-11-9-18(10-12-19)21(26)23-14-20(25)22-13-16(3)17-7-5-4-6-8-17/h4-12,15-16,24H,13-14H2,1-3H3,(H,22,25)(H,23,26)/t16-/m0/s1 |
| InChIKey | AFUKSZRDNQYJJS-INIZCTEOSA-N |
| XLogP | 2.02 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |