C14H12F2N2O — CID 94274466
1-(3,4-difluorophenyl)-2-(pyridin-2-ylmethylamino)ethanone (PubChem CID 94274466) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(pyridin-2-ylmethylamino)ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-(pyridin-2-ylmethylamino)ethanone |
|---|---|
| PubChem CID | 94274466 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(pyridin-2-ylmethylamino)ethanone |
| SMILES | O=C(CNCc1ccccn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12F2N2O/c15-12-5-4-10(7-13(12)16)14(19)9-17-8-11-3-1-2-6-18-11/h1-7,17H,8-9H2 |
| InChIKey | DUTMVJCPUAYYFU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |