About 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide
5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide (PubChem CID 9428023) has the molecular formula C16H11FN2O3S
and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide |
| PubChem CID | 9428023 |
| Molecular Formula | C16H11FN2O3S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccs1)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C16H11FN2O3S/c17-11-5-2-1-4-10(11)12-7-8-13(22-12)15(20)18-19-16(21)14-6-3-9-23-14/h1-9H,(H,18,20)(H,19,21) |
| InChIKey | ATYZTZYPECKZIR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide?
The IUPAC name of 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide (CID 9428023) is 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide.
What is the SMILES notation for 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide?
The canonical SMILES for 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide is O=C(NNC(=O)c1cccs1)c1ccc(-c2ccccc2F)o1.
What is the InChIKey of 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide?
The InChIKey is ATYZTZYPECKZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN2O3S/c17-11-5-2-1-4-10(11)12-7-8-13(22-12)15(20)18-19-16(21)14-6-3-9-23-14/h1-9H,(H,18,20)(H,19,21).
What are the key properties of 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide?
5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide has a molecular weight of 330.34 g/mol, XLogP of 3.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenyl)-N'-(thiophene-2-carbonyl)furan-2-carbohydrazide is sourced from PubChem (CID 9428023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).