C9H11N3O3S — CID 942844
5-(morpholin-4-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 942844) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 5-(morpholin-4-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(morpholin-4-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 942844 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-(morpholin-4-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=CN1CCOCC1 |
| InChI | InChI=1S/C9H11N3O3S/c13-7-6(8(14)11-9(16)10-7)5-12-1-3-15-4-2-12/h5H,1-4H2,(H2,10,11,13,14,16) |
| InChIKey | HNITZUYJBSOGQH-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|