C14H16N2O4 — CID 94285024
4-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]piperazine-1-carbaldehyde (PubChem CID 94285024) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 94285024 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(CC(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C14H16N2O4/c17-9-16-5-3-15(4-6-16)8-12(18)11-1-2-13-14(7-11)20-10-19-13/h1-2,7,9H,3-6,8,10H2 |
| InChIKey | XSRVTXIPPNWTJN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|