C20H24N2O3S2 — CID 9428996
(5R)-N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 9428996) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is (5R)-N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5R)-N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9428996 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (5R)-N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | CCOc1ccc(SCC(=O)NNC(=O)c2cc3c(s2)CC[C@@H](C)C3)cc1 |
| InChI | InChI=1S/C20H24N2O3S2/c1-3-25-15-5-7-16(8-6-15)26-12-19(23)21-22-20(24)18-11-14-10-13(2)4-9-17(14)27-18/h5-8,11,13H,3-4,9-10,12H2,1-2H3,(H,21,23)(H,22,24)/t13-/m1/s1 |
| InChIKey | VYCQYZABHHHKDU-CYBMUJFWSA-N |
| XLogP | 3.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|