C18H17N3O4S — CID 9429063
4-(cyanomethylsulfonylmethyl)-N-[4-(methylcarbamoyl)phenyl]benzamide (PubChem CID 9429063) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-(cyanomethylsulfonylmethyl)-N-[4-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-(cyanomethylsulfonylmethyl)-N-[4-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 9429063 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(cyanomethylsulfonylmethyl)-N-[4-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2ccc(CS(=O)(=O)CC#N)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-20-17(22)14-6-8-16(9-7-14)21-18(23)15-4-2-13(3-5-15)12-26(24,25)11-10-19/h2-9H,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | XGGNIRRPLVXCOX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |