About propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate
propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (PubChem CID 9429895) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| PubChem CID | 9429895 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| SMILES | COc1cc(NC(=O)CCC(=O)OC(C)C)nc(OC)n1 |
| InChI | InChI=1S/C13H19N3O5/c1-8(2)21-12(18)6-5-10(17)14-9-7-11(19-3)16-13(15-9)20-4/h7-8H,5-6H2,1-4H3,(H,14,15,16,17) |
| InChIKey | YITKEAKSLMSETF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
The IUPAC name of propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (CID 9429895) is propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
What is the SMILES notation for propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
The canonical SMILES for propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate is COc1cc(NC(=O)CCC(=O)OC(C)C)nc(OC)n1.
What is the InChIKey of propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
The InChIKey is YITKEAKSLMSETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-8(2)21-12(18)6-5-10(17)14-9-7-11(19-3)16-13(15-9)20-4/h7-8H,5-6H2,1-4H3,(H,14,15,16,17).
What are the key properties of propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate?
propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate has a molecular weight of 297.31 g/mol, XLogP of 1.16, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate is sourced from PubChem (CID 9429895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).