C12H10N4O2S3 — CID 9430119
methyl (E)-3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enoate (PubChem CID 9430119) has the molecular formula C12H10N4O2S3 and a molecular weight of 338.44 g/mol. Its IUPAC name is methyl (E)-3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 9430119 |
| Molecular Formula | C12H10N4O2S3 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | methyl (E)-3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cc(CSc2nnc(N)s2)cs1 |
| InChI | InChI=1S/C12H10N4O2S3/c1-18-10(17)8(4-13)3-9-2-7(5-19-9)6-20-12-16-15-11(14)21-12/h2-3,5H,6H2,1H3,(H2,14,15)/b8-3+ |
| InChIKey | MQJLPCMGULHXIX-FPYGCLRLSA-N |
| XLogP | 2.55 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|