C24H32N2O2 — CID 9430598
(2S)-2-(4-benzylpiperidin-1-yl)-N-[2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 9430598) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2S)-2-(4-benzylpiperidin-1-yl)-N-[2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-(4-benzylpiperidin-1-yl)-N-[2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 9430598 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | (2S)-2-(4-benzylpiperidin-1-yl)-N-[2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)[C@H](C)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-19(24(27)25-15-12-20-8-10-23(28-2)11-9-20)26-16-13-22(14-17-26)18-21-6-4-3-5-7-21/h3-11,19,22H,12-18H2,1-2H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | RRUDZNIPHJWVLY-IBGZPJMESA-N |
| XLogP | 3.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |