About 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline
2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline (PubChem CID 943197) has the molecular formula C19H16N4O
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline |
| PubChem CID | 943197 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline |
| SMILES | C=CCn1c(-c2cccc(OC)c2)nc2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H16N4O/c1-3-11-23-18(13-7-6-8-14(12-13)24-2)22-17-19(23)21-16-10-5-4-9-15(16)20-17/h3-10,12H,1,11H2,2H3 |
| InChIKey | KNOKDCYSVKCKSB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline?
The IUPAC name of 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline (CID 943197) is 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline.
What is the SMILES notation for 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline?
The canonical SMILES for 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline is C=CCn1c(-c2cccc(OC)c2)nc2nc3ccccc3nc21.
What is the InChIKey of 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline?
The InChIKey is KNOKDCYSVKCKSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O/c1-3-11-23-18(13-7-6-8-14(12-13)24-2)22-17-19(23)21-16-10-5-4-9-15(16)20-17/h3-10,12H,1,11H2,2H3.
What are the key properties of 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline?
2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline has a molecular weight of 316.36 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-3-prop-2-enylimidazo[4,5-b]quinoxaline is sourced from PubChem (CID 943197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).