C21H27N3O3 — CID 9432648
(2S)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)propanamide (PubChem CID 9432648) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (2S)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)propanamide.
| Compound Name | (2S)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 9432648 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (2S)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)propanamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-15-8-9-20(27-3)17(14-15)22-21(26)16(2)23-10-12-24(13-11-23)18-6-4-5-7-19(18)25/h4-9,14,16,25H,10-13H2,1-3H3,(H,22,26)/t16-/m0/s1 |
| InChIKey | NJTAMJCIAZETBV-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |