C16H26N3O2+ — CID 9433236
ethyl-[2-(ethylamino)-2-oxoethyl]-[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl]azanium (PubChem CID 9433236) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is ethyl-[2-(ethylamino)-2-oxoethyl]-[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | ethyl-[2-(ethylamino)-2-oxoethyl]-[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9433236 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | ethyl-[2-(ethylamino)-2-oxoethyl]-[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl]azanium |
| SMILES | CCNC(=O)C[NH+](CC)[C@@H](C)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-17-15(20)12-19(6-2)13(3)16(21)18(4)14-10-8-7-9-11-14/h7-11,13H,5-6,12H2,1-4H3,(H,17,20)/p+1/t13-/m0/s1 |
| InChIKey | NKVYZYSAMGBCRT-ZDUSSCGKSA-O |
| XLogP | 0.08 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |