C19H23FN4O — CID 94333135
2-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone (PubChem CID 94333135) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 94333135 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[[(1R)-1-(3-fluorophenyl)ethyl]amino]-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
| SMILES | C[C@@H](NCC(=O)N1CCN(c2ccccn2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN4O/c1-15(16-5-4-6-17(20)13-16)22-14-19(25)24-11-9-23(10-12-24)18-7-2-3-8-21-18/h2-8,13,15,22H,9-12,14H2,1H3/t15-/m1/s1 |
| InChIKey | SUOQEODWHFKDPZ-OAHLLOKOSA-N |
| XLogP | 2.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |