C22H27FN4O2 — CID 9433591
(2R)-2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-N-phenylpropanamide (PubChem CID 9433591) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is (2R)-2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-N-phenylpropanamide.
| Compound Name | (2R)-2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 9433591 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (2R)-2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-N-phenylpropanamide |
| SMILES | C[C@H](C(=O)N(C)c1ccccc1)N1CCN(CC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H27FN4O2/c1-17(22(29)25(2)20-9-4-3-5-10-20)27-13-11-26(12-14-27)16-21(28)24-19-8-6-7-18(23)15-19/h3-10,15,17H,11-14,16H2,1-2H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | RAGGUXVSHZMBPY-QGZVFWFLSA-N |
| XLogP | 2.43 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |