C15H20ClN3O2 — CID 94337006
[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2-propan-2-ylpyrimidin-4-yl)methanone (PubChem CID 94337006) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2-propan-2-ylpyrimidin-4-yl)methanone.
| Compound Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2-propan-2-ylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 94337006 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2-propan-2-ylpyrimidin-4-yl)methanone |
| SMILES | CC(C)c1ncc(Cl)c(C(=O)N2CCO[C@@H]3CCC[C@H]32)n1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-9(2)14-17-8-10(16)13(18-14)15(20)19-6-7-21-12-5-3-4-11(12)19/h8-9,11-12H,3-7H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | ZCKIJLNHAZPROY-VXGBXAGGSA-N |
| XLogP | 2.65 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |