About (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate
(8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate (PubChem CID 943384) has the molecular formula C16H13NO3S
and a molecular weight of 299.35 g/mol. Its IUPAC name is (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate |
| PubChem CID | 943384 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate |
| SMILES | Cc1cccc2cc(COC(=O)c3cccs3)c(=O)[nH]c12 |
| InChI | InChI=1S/C16H13NO3S/c1-10-4-2-5-11-8-12(15(18)17-14(10)11)9-20-16(19)13-6-3-7-21-13/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | BOODXGBQVFUTGZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate?
The IUPAC name of (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate (CID 943384) is (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate.
What is the SMILES notation for (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate?
The canonical SMILES for (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate is Cc1cccc2cc(COC(=O)c3cccs3)c(=O)[nH]c12.
What is the InChIKey of (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate?
The InChIKey is BOODXGBQVFUTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3S/c1-10-4-2-5-11-8-12(15(18)17-14(10)11)9-20-16(19)13-6-3-7-21-13/h2-8H,9H2,1H3,(H,17,18).
What are the key properties of (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate?
(8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate has a molecular weight of 299.35 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-2-oxo-1H-quinolin-3-yl)methyl thiophene-2-carboxylate is sourced from PubChem (CID 943384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).