C11H15BrN2O2S — CID 94340271
(3S)-1-(5-bromo-2-methylphenyl)sulfonylpyrrolidin-3-amine (PubChem CID 94340271) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is (3S)-1-(5-bromo-2-methylphenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(5-bromo-2-methylphenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 94340271 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | (3S)-1-(5-bromo-2-methylphenyl)sulfonylpyrrolidin-3-amine |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)N1CC[C@H](N)C1 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-8-2-3-9(12)6-11(8)17(15,16)14-5-4-10(13)7-14/h2-3,6,10H,4-5,7,13H2,1H3/t10-/m0/s1 |
| InChIKey | WUAPYENQFQLYIQ-JTQLQIEISA-N |
| XLogP | 1.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |