C7H15N3O — CID 94340497
2-[(3R)-3-aminopyrrolidin-1-yl]-N-methylacetamide (PubChem CID 94340497) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-[(3R)-3-aminopyrrolidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[(3R)-3-aminopyrrolidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 94340497 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 2-[(3R)-3-aminopyrrolidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CC[C@@H](N)C1 |
| InChI | InChI=1S/C7H15N3O/c1-9-7(11)5-10-3-2-6(8)4-10/h6H,2-5,8H2,1H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | ORRIUBXRIGFDFL-ZCFIWIBFSA-N |
| XLogP | -1.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |