C16H21N3O3S2 — CID 9434113
(2S)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 9434113) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is (2S)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2S)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 9434113 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (2S)-2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | Cc1ccsc1CN(C)[C@@H](C)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-11-8-9-23-15(11)10-19(3)12(2)16(20)18-13-4-6-14(7-5-13)24(17,21)22/h4-9,12H,10H2,1-3H3,(H,18,20)(H2,17,21,22)/t12-/m0/s1 |
| InChIKey | ITDLWJGRUWKDFP-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |