C21H31ClN4O2 — CID 9434473
2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 9434473) has the molecular formula C21H31ClN4O2 and a molecular weight of 406.96 g/mol. Its IUPAC name is 2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 9434473 |
| Molecular Formula | C21H31ClN4O2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | O=C(CN1CCN(CC(=O)Nc2ccccc2Cl)CC1)NCC1CCCCC1 |
| InChI | InChI=1S/C21H31ClN4O2/c22-18-8-4-5-9-19(18)24-21(28)16-26-12-10-25(11-13-26)15-20(27)23-14-17-6-2-1-3-7-17/h4-5,8-9,17H,1-3,6-7,10-16H2,(H,23,27)(H,24,28) |
| InChIKey | HRUBFRNIZAESBJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |