C24H26FN2O3+ — CID 9434514
[2-(3-fluoroanilino)-2-oxoethyl]-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-methylazanium (PubChem CID 9434514) has the molecular formula C24H26FN2O3+ and a molecular weight of 409.48 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl]-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl]-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9434514 |
| Molecular Formula | C24H26FN2O3+ |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl]-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cc(C[NH+](C)CC(=O)Nc2cccc(F)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25FN2O3/c1-27(16-24(28)26-21-10-6-9-20(25)14-21)15-19-11-12-22(23(13-19)29-2)30-17-18-7-4-3-5-8-18/h3-14H,15-17H2,1-2H3,(H,26,28)/p+1 |
| InChIKey | JYSZLCNRXJYCGD-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |