C22H26N3O5+ — CID 9434844
2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide (PubChem CID 9434844) has the molecular formula C22H26N3O5+ and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide.
| Compound Name | 2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9434844 |
| Molecular Formula | C22H26N3O5+ |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-6-nitrophenyl)acetamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)C[NH+]1CCC[C@@H]1c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H25N3O5/c1-15-5-2-6-18(25(27)28)22(15)23-21(26)14-24-10-3-7-17(24)16-8-9-19-20(13-16)30-12-4-11-29-19/h2,5-6,8-9,13,17H,3-4,7,10-12,14H2,1H3,(H,23,26)/p+1/t17-/m1/s1 |
| InChIKey | AUIGPVDBTXDHOA-QGZVFWFLSA-O |
| XLogP | 2.42 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|