C18H28FN3O2 — CID 9436232
N-[(2S)-butan-2-yl]-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 9436232) has the molecular formula C18H28FN3O2 and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9436232 |
| Molecular Formula | C18H28FN3O2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)CN1CCN(Cc2cc(F)ccc2OC)CC1 |
| InChI | InChI=1S/C18H28FN3O2/c1-4-14(2)20-18(23)13-22-9-7-21(8-10-22)12-15-11-16(19)5-6-17(15)24-3/h5-6,11,14H,4,7-10,12-13H2,1-3H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | YMHOPFLMYDQNEB-AWEZNQCLSA-N |
| XLogP | 1.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |