C16H12N4OS — CID 943702
(2S)-6-oxo-3-phenyl-2-pyridin-3-yl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile (PubChem CID 943702) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is (2S)-6-oxo-3-phenyl-2-pyridin-3-yl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile.
| Compound Name | (2S)-6-oxo-3-phenyl-2-pyridin-3-yl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 943702 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (2S)-6-oxo-3-phenyl-2-pyridin-3-yl-4-sulfanyl-1,2-dihydropyrimidine-5-carbonitrile |
| SMILES | N#CC1=C(S)N(c2ccccc2)[C@@H](c2cccnc2)NC1=O |
| InChI | InChI=1S/C16H12N4OS/c17-9-13-15(21)19-14(11-5-4-8-18-10-11)20(16(13)22)12-6-2-1-3-7-12/h1-8,10,14,22H,(H,19,21)/t14-/m0/s1 |
| InChIKey | ILGYPBMYZIFOQW-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|