About 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine
6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine (PubChem CID 9437389) has the molecular formula C16H11N3S3
and a molecular weight of 341.49 g/mol. Its IUPAC name is 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine |
| PubChem CID | 9437389 |
| Molecular Formula | C16H11N3S3 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2cc3c(SCc4cscn4)ncnc3s2)cc1 |
| InChI | InChI=1S/C16H11N3S3/c1-2-4-11(5-3-1)14-6-13-15(17-9-18-16(13)22-14)21-8-12-7-20-10-19-12/h1-7,9-10H,8H2 |
| InChIKey | JVQQPCONJOBOAZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine?
The IUPAC name of 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine (CID 9437389) is 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine is c1ccc(-c2cc3c(SCc4cscn4)ncnc3s2)cc1.
What is the InChIKey of 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine?
The InChIKey is JVQQPCONJOBOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3S3/c1-2-4-11(5-3-1)14-6-13-15(17-9-18-16(13)22-14)21-8-12-7-20-10-19-12/h1-7,9-10H,8H2.
What are the key properties of 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine?
6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine has a molecular weight of 341.49 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-4-(1,3-thiazol-4-ylmethylsulfanyl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 9437389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).