C21H26N2O2 — CID 9437869
(3R)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenylbutanamide (PubChem CID 9437869) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3R)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenylbutanamide.
| Compound Name | (3R)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 9437869 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3R)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)C[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-15-9-8-10-16(2)21(15)22-19(24)14-23(4)20(25)13-17(3)18-11-6-5-7-12-18/h5-12,17H,13-14H2,1-4H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | UTYUOYPWOPYDMC-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |