C27H20Cl3N3OS — CID 94379428
N-[(1S)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]naphthalene-1-carboxamide (PubChem CID 94379428) has the molecular formula C27H20Cl3N3OS and a molecular weight of 540.90 g/mol. Its IUPAC name is N-[(1S)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]naphthalene-1-carboxamide.
| Compound Name | N-[(1S)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 94379428 |
| Molecular Formula | C27H20Cl3N3OS |
| Molecular Weight | 540.90 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | N-[(1S)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]naphthalene-1-carboxamide |
| SMILES | O=C(N[C@@H](n1c(SCc2ccccc2)nc2ccccc21)C(Cl)(Cl)Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H20Cl3N3OS/c28-27(29,30)25(32-24(34)21-14-8-12-19-11-4-5-13-20(19)21)33-23-16-7-6-15-22(23)31-26(33)35-17-18-9-2-1-3-10-18/h1-16,25H,17H2,(H,32,34)/t25-/m0/s1 |
| InChIKey | WBHDFQLIHLMRJQ-VWLOTQADSA-N |
| XLogP | 7.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.90 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|