C17H20F2N2O3 — CID 94385394
3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 94385394) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is 3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 94385394 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(C[C@@H](O)c2ccc(F)cc2F)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C17H20F2N2O3/c1-20-16(24)21(15(23)17(20)7-3-2-4-8-17)10-14(22)12-6-5-11(18)9-13(12)19/h5-6,9,14,22H,2-4,7-8,10H2,1H3/t14-/m1/s1 |
| InChIKey | GJGOBXCZTANUCX-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|