C21H25N3O5 — CID 9438552
4-ethoxy-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide (PubChem CID 9438552) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9438552 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-ethoxy-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N(C)CC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-4-29-18-9-5-15(6-10-18)21(27)22-13-20(26)24(2)14-19(25)23-16-7-11-17(28-3)12-8-16/h5-12H,4,13-14H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | STTYOAYCTWDEOO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |