C22H29N3O3 — CID 94387273
(1R,5S)-3-[(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 94387273) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (1R,5S)-3-[(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 94387273 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (1R,5S)-3-[(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1cc2ncn(C[C@@H](O)CN3C(=O)[C@H]4CC[C@@](C)(C3=O)C4(C)C)c2cc1C |
| InChI | InChI=1S/C22H29N3O3/c1-13-8-17-18(9-14(13)2)24(12-23-17)10-15(26)11-25-19(27)16-6-7-22(5,20(25)28)21(16,3)4/h8-9,12,15-16,26H,6-7,10-11H2,1-5H3/t15-,16-,22+/m1/s1 |
| InChIKey | OOYSWGHWCYIWMG-MCFFVMPBSA-N |
| XLogP | 2.83 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|