C23H18ClN3O2 — CID 94387276
2-[(2R)-2-(2-chlorophenyl)-2-hydroxyethyl]-5,6-diphenyl-1,2,4-triazin-3-one (PubChem CID 94387276) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 2-[(2R)-2-(2-chlorophenyl)-2-hydroxyethyl]-5,6-diphenyl-1,2,4-triazin-3-one.
| Compound Name | 2-[(2R)-2-(2-chlorophenyl)-2-hydroxyethyl]-5,6-diphenyl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 94387276 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[(2R)-2-(2-chlorophenyl)-2-hydroxyethyl]-5,6-diphenyl-1,2,4-triazin-3-one |
| SMILES | O=c1nc(-c2ccccc2)c(-c2ccccc2)nn1C[C@H](O)c1ccccc1Cl |
| InChI | InChI=1S/C23H18ClN3O2/c24-19-14-8-7-13-18(19)20(28)15-27-23(29)25-21(16-9-3-1-4-10-16)22(26-27)17-11-5-2-6-12-17/h1-14,20,28H,15H2/t20-/m0/s1 |
| InChIKey | UKAVBZBFMDVYQS-FQEVSTJZSA-N |
| XLogP | 4.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |