C16H23NO3 — CID 94394263
(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(3-methoxypropyl)pyrrolidine (PubChem CID 94394263) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(3-methoxypropyl)pyrrolidine.
| Compound Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(3-methoxypropyl)pyrrolidine |
|---|---|
| PubChem CID | 94394263 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(3-methoxypropyl)pyrrolidine |
| SMILES | COCCCN1CCC[C@@H]1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H23NO3/c1-18-9-3-8-17-7-2-4-14(17)13-5-6-15-16(12-13)20-11-10-19-15/h5-6,12,14H,2-4,7-11H2,1H3/t14-/m1/s1 |
| InChIKey | PUNOODDLDKSOHP-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|