C22H26N2O6 — CID 9439853
N'-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]-4-ethoxy-3-methoxybenzohydrazide (PubChem CID 9439853) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is N'-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]-4-ethoxy-3-methoxybenzohydrazide.
| Compound Name | N'-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]-4-ethoxy-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9439853 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N'-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]-4-ethoxy-3-methoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)COc2cccc3c2OC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C22H26N2O6/c1-5-28-16-10-9-14(11-18(16)27-4)21(26)24-23-19(25)13-29-17-8-6-7-15-12-22(2,3)30-20(15)17/h6-11H,5,12-13H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | WSEVYOQESBJOEJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|