C12H14N2O — CID 94406444
2-[[(2R)-pyrrolidin-2-yl]methoxy]benzonitrile (PubChem CID 94406444) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[[(2R)-pyrrolidin-2-yl]methoxy]benzonitrile.
| Compound Name | 2-[[(2R)-pyrrolidin-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 94406444 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[[(2R)-pyrrolidin-2-yl]methoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OC[C@H]1CCCN1 |
| InChI | InChI=1S/C12H14N2O/c13-8-10-4-1-2-6-12(10)15-9-11-5-3-7-14-11/h1-2,4,6,11,14H,3,5,7,9H2/t11-/m1/s1 |
| InChIKey | MATREPYERFPXPQ-LLVKDONJSA-N |
| XLogP | 1.69 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |