About 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide
1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide (PubChem CID 9440730) has the molecular formula C23H26N4O2S
and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide |
| PubChem CID | 9440730 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)C(=O)c1c(C)nn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C23H26N4O2S/c1-16-22(17(2)27(25-16)14-18-10-6-5-7-11-18)23(29)26(3)15-21(28)24-19-12-8-9-13-20(19)30-4/h5-13H,14-15H2,1-4H3,(H,24,28) |
| InChIKey | AGYKODRCTUOAGL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide?
The IUPAC name of 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide (CID 9440730) is 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide.
What is the SMILES notation for 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide?
The canonical SMILES for 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide is CSc1ccccc1NC(=O)CN(C)C(=O)c1c(C)nn(Cc2ccccc2)c1C.
What is the InChIKey of 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide?
The InChIKey is AGYKODRCTUOAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O2S/c1-16-22(17(2)27(25-16)14-18-10-6-5-7-11-18)23(29)26(3)15-21(28)24-19-12-8-9-13-20(19)30-4/h5-13H,14-15H2,1-4H3,(H,24,28).
What are the key properties of 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide?
1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide has a molecular weight of 422.55 g/mol, XLogP of 3.98, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N,3,5-trimethyl-N-[2-(2-methylsulfanylanilino)-2-oxoethyl]pyrazole-4-carboxamide is sourced from PubChem (CID 9440730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).