About (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one
(3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one (PubChem CID 944133) has the molecular formula C18H15Cl2NO2
and a molecular weight of 348.23 g/mol. Its IUPAC name is (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one.
Molecular Properties
| Compound Name | (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one |
| PubChem CID | 944133 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one |
| SMILES | CCO/C(C)=C1/C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H15Cl2NO2/c1-3-23-11(2)16-12-7-4-5-10-15(12)21(18(16)22)17-13(19)8-6-9-14(17)20/h4-10H,3H2,1-2H3/b16-11+ |
| InChIKey | ZHSFUUGJHNEJEF-LFIBNONCSA-N |
| XLogP | 5.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one?
The IUPAC name of (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one (CID 944133) is (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one.
What is the SMILES notation for (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one?
The canonical SMILES for (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one is CCO/C(C)=C1/C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21.
What is the InChIKey of (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one?
The InChIKey is ZHSFUUGJHNEJEF-LFIBNONCSA-N. The full InChI is InChI=1S/C18H15Cl2NO2/c1-3-23-11(2)16-12-7-4-5-10-15(12)21(18(16)22)17-13(19)8-6-9-14(17)20/h4-10H,3H2,1-2H3/b16-11+.
What are the key properties of (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one?
(3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one has a molecular weight of 348.23 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-(2,6-dichlorophenyl)-3-(1-ethoxyethylidene)indol-2-one is sourced from PubChem (CID 944133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).