C18H23N3O — CID 94414210
(4aS,8aS)-4-[(3-methylquinoxalin-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 94414210) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is (4aS,8aS)-4-[(3-methylquinoxalin-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aS,8aS)-4-[(3-methylquinoxalin-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 94414210 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (4aS,8aS)-4-[(3-methylquinoxalin-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | Cc1nc2ccccc2nc1CN1CCO[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H23N3O/c1-13-16(20-15-7-3-2-6-14(15)19-13)12-21-10-11-22-18-9-5-4-8-17(18)21/h2-3,6-7,17-18H,4-5,8-12H2,1H3/t17-,18-/m0/s1 |
| InChIKey | KDHJQPVRPNVHDR-ROUUACIJSA-N |
| XLogP | 3.08 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |