C16H23N3OS — CID 944146
5-cyclohexyl-1-(3-methoxyphenyl)-1,3,5-triazinane-2-thione (PubChem CID 944146) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 5-cyclohexyl-1-(3-methoxyphenyl)-1,3,5-triazinane-2-thione.
| Compound Name | 5-cyclohexyl-1-(3-methoxyphenyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 944146 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 5-cyclohexyl-1-(3-methoxyphenyl)-1,3,5-triazinane-2-thione |
| SMILES | COc1cccc(N2CN(C3CCCCC3)CNC2=S)c1 |
| InChI | InChI=1S/C16H23N3OS/c1-20-15-9-5-8-14(10-15)19-12-18(11-17-16(19)21)13-6-3-2-4-7-13/h5,8-10,13H,2-4,6-7,11-12H2,1H3,(H,17,21) |
| InChIKey | YQJJGXBUNWTCBP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|