About (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid
(E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid (PubChem CID 94415083) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid |
| PubChem CID | 94415083 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H15NO4/c12-8-4-2-1-3-7(8)11-9(13)5-6-10(14)15/h5-8,12H,1-4H2,(H,11,13)(H,14,15)/b6-5+/t7-,8-/m0/s1 |
| InChIKey | IHOUPTHMWGRVCV-JBGJSGBSSA-N |
| XLogP | 0.05 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid (CID 94415083) is (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid is O=C(O)/C=C/C(=O)N[C@H]1CCCC[C@@H]1O.
What is the InChIKey of (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid?
The InChIKey is IHOUPTHMWGRVCV-JBGJSGBSSA-N. The full InChI is InChI=1S/C10H15NO4/c12-8-4-2-1-3-7(8)11-9(13)5-6-10(14)15/h5-8,12H,1-4H2,(H,11,13)(H,14,15)/b6-5+/t7-,8-/m0/s1.
What are the key properties of (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid?
(E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid has a molecular weight of 213.23 g/mol, XLogP of 0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 94415083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).